C34H43N5O8S — CID 123713255
4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]thiophen-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123713255) has the molecular formula C34H43N5O8S and a molecular weight of 681.81 g/mol. Its IUPAC name is 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]thiophen-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]thiophen-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123713255 |
| Molecular Formula | C34H43N5O8S |
| Molecular Weight | 681.81 g/mol |
| Exact Mass | 681.28 |
| IUPAC Name | 4,7-bis(dimethylamino)-10,12a-dihydroxy-9-[5-[[4-(2-hydroxyethyl)piperazin-1-yl]methyl]thiophen-2-yl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(CN3CCN(CCO)CC3)s2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C34H43N5O8S/c1-36(2)22-15-20(23-6-5-18(48-23)16-39-9-7-38(8-10-39)11-12-40)28(41)25-19(22)13-17-14-21-27(37(3)4)30(43)26(33(35)46)32(45)34(21,47)31(44)24(17)29(25)42/h5-6,15,17,21,24,26-27,40-41,47H,7-14,16H2,1-4H3,(H2,35,46) |
| InChIKey | VDUNFPPQNCMBAG-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 185.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.81 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|