C32H40N4O7S — CID 123784992
9-[5-[(tert-butylamino)methyl]thiophen-2-yl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 123784992) has the molecular formula C32H40N4O7S and a molecular weight of 624.76 g/mol. Its IUPAC name is 9-[5-[(tert-butylamino)methyl]thiophen-2-yl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 9-[5-[(tert-butylamino)methyl]thiophen-2-yl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 123784992 |
| Molecular Formula | C32H40N4O7S |
| Molecular Weight | 624.76 g/mol |
| Exact Mass | 624.26 |
| IUPAC Name | 9-[5-[(tert-butylamino)methyl]thiophen-2-yl]-4,7-bis(dimethylamino)-10,12a-dihydroxy-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | CN(C)c1cc(-c2ccc(CNC(C)(C)C)s2)c(O)c2c1CC1CC3C(N(C)C)C(=O)C(C(N)=O)C(=O)C3(O)C(=O)C1C2=O |
| InChI | InChI=1S/C32H40N4O7S/c1-31(2,3)34-13-15-8-9-20(44-15)17-12-19(35(4)5)16-10-14-11-18-24(36(6)7)27(39)23(30(33)42)29(41)32(18,43)28(40)21(14)26(38)22(16)25(17)37/h8-9,12,14,18,21,23-24,34,37,43H,10-11,13H2,1-7H3,(H2,33,42) |
| InChIKey | KTFRLGKHGCREDM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.76 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|