C16H19N4+ — CID 123720479
2,5-diethyl-8-methyl-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),3,7,9,11,13-hexaene (PubChem CID 123720479) has the molecular formula C16H19N4+ and a molecular weight of 267.36 g/mol. Its IUPAC name is 2,5-diethyl-8-methyl-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),3,7,9,11,13-hexaene.
| Compound Name | 2,5-diethyl-8-methyl-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),3,7,9,11,13-hexaene |
|---|---|
| PubChem CID | 123720479 |
| Molecular Formula | C16H19N4+ |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 2,5-diethyl-8-methyl-6,7,9-triaza-1-azoniatetracyclo[9.4.0.02,5.06,10]pentadeca-1(15),3,7,9,11,13-hexaene |
| SMILES | CCC12C=CC1(CC)[n+]1ccccc1-c1nc(C)nn12 |
| InChI | InChI=1S/C16H19N4/c1-4-15-9-10-16(15,5-2)20-14(17-12(3)18-20)13-8-6-7-11-19(13)15/h6-11H,4-5H2,1-3H3/q+1 |
| InChIKey | KBIKKNIIEDYNTC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|