C38H39N7O+2 — CID 123836383
7,8-diethyl-4,7-dimethyl-8-[3-[6-(3-methyldibenzofuran-2-yl)pyrido[2,3-b]pyrazin-5-ium-5-yl]propyl]-3,5,6-triaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaene (PubChem CID 123836383) has the molecular formula C38H39N7O+2 and a molecular weight of 609.78 g/mol. Its IUPAC name is 7,8-diethyl-4,7-dimethyl-8-[3-[6-(3-methyldibenzofuran-2-yl)pyrido[2,3-b]pyrazin-5-ium-5-yl]propyl]-3,5,6-triaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaene.
| Compound Name | 7,8-diethyl-4,7-dimethyl-8-[3-[6-(3-methyldibenzofuran-2-yl)pyrido[2,3-b]pyrazin-5-ium-5-yl]propyl]-3,5,6-triaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaene |
|---|---|
| PubChem CID | 123836383 |
| Molecular Formula | C38H39N7O+2 |
| Molecular Weight | 609.78 g/mol |
| Exact Mass | 609.32 |
| IUPAC Name | 7,8-diethyl-4,7-dimethyl-8-[3-[6-(3-methyldibenzofuran-2-yl)pyrido[2,3-b]pyrazin-5-ium-5-yl]propyl]-3,5,6-triaza-9-azoniatricyclo[7.4.0.02,6]trideca-1(13),2,4,9,11-pentaene |
| SMILES | CCC1(C)n2nc(C)nc2-c2cccc[n+]2C1(CC)CCC[n+]1c(-c2cc3c(cc2C)oc2ccccc23)ccc2nccnc21 |
| InChI | InChI=1S/C38H39N7O/c1-6-37(5)38(7-2,44-22-11-10-14-32(44)36-41-26(4)42-45(36)37)18-12-21-43-31(17-16-30-35(43)40-20-19-39-30)28-24-29-27-13-8-9-15-33(27)46-34(29)23-25(28)3/h8-11,13-17,19-20,22-24H,6-7,12,18,21H2,1-5H3/q+2 |
| InChIKey | OIPJZMWAHJDVCT-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 77.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|