C6H12Cl2N2 — CID 123722013
2,4-dichloro-1,3-dimethyl-1,3-diazinane (PubChem CID 123722013) has the molecular formula C6H12Cl2N2 and a molecular weight of 183.08 g/mol. Its IUPAC name is 2,4-dichloro-1,3-dimethyl-1,3-diazinane.
| Compound Name | 2,4-dichloro-1,3-dimethyl-1,3-diazinane |
|---|---|
| PubChem CID | 123722013 |
| Molecular Formula | C6H12Cl2N2 |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 2,4-dichloro-1,3-dimethyl-1,3-diazinane |
| SMILES | CN1CCC(Cl)N(C)C1Cl |
| InChI | InChI=1S/C6H12Cl2N2/c1-9-4-3-5(7)10(2)6(9)8/h5-6H,3-4H2,1-2H3 |
| InChIKey | KJKZLIFNOTWSCV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|