C21H40N2O7 — CID 123724561
(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-[(2S)-1-[2-(2-methylpropoxy)ethylamino]-1-oxopropan-2-yl]non-6-enamide (PubChem CID 123724561) has the molecular formula C21H40N2O7 and a molecular weight of 432.56 g/mol. Its IUPAC name is (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-[(2S)-1-[2-(2-methylpropoxy)ethylamino]-1-oxopropan-2-yl]non-6-enamide.
| Compound Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-[(2S)-1-[2-(2-methylpropoxy)ethylamino]-1-oxopropan-2-yl]non-6-enamide |
|---|---|
| PubChem CID | 123724561 |
| Molecular Formula | C21H40N2O7 |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.28 |
| IUPAC Name | (2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-N-[(2S)-1-[2-(2-methylpropoxy)ethylamino]-1-oxopropan-2-yl]non-6-enamide |
| SMILES | CO[C@@H](C(=O)N[C@@H](C)C(=O)NCCOCC(C)C)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C21H40N2O7/c1-13(2)12-30-11-10-22-19(27)14(3)23-20(28)18(29-7)17(26)16(25)15(24)8-9-21(4,5)6/h8-9,13-18,24-26H,10-12H2,1-7H3,(H,22,27)(H,23,28)/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | RJWVPYCHTOVUSK-IGKNDFSCSA-N |
| XLogP | -0.02 |
| TPSA | 137.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|