C26H47N3O9 — CID 90953411
tert-butyl N-[3-[(3S,6S)-6-hydroxy-2-oxo-3-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-1-yl]propyl]carbamate (PubChem CID 90953411) has the molecular formula C26H47N3O9 and a molecular weight of 545.67 g/mol. Its IUPAC name is tert-butyl N-[3-[(3S,6S)-6-hydroxy-2-oxo-3-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-1-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(3S,6S)-6-hydroxy-2-oxo-3-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-1-yl]propyl]carbamate |
|---|---|
| PubChem CID | 90953411 |
| Molecular Formula | C26H47N3O9 |
| Molecular Weight | 545.67 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | tert-butyl N-[3-[(3S,6S)-6-hydroxy-2-oxo-3-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-1-yl]propyl]carbamate |
| SMILES | CO[C@@H](C(=O)N[C@H]1CC[C@H](O)CN(CCCNC(=O)OC(C)(C)C)C1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C26H47N3O9/c1-25(2,3)12-11-18(31)19(32)20(33)21(37-7)22(34)28-17-10-9-16(30)15-29(23(17)35)14-8-13-27-24(36)38-26(4,5)6/h11-12,16-21,30-33H,8-10,13-15H2,1-7H3,(H,27,36)(H,28,34)/t16-,17-,18+,19-,20+,21+/m0/s1 |
| InChIKey | YYFKOFLGLQLOCY-OXVGXARHSA-N |
| XLogP | 0.07 |
| TPSA | 177.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.67 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|