C21H36N2O8 — CID 123136420
2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl cyclopropanecarboxylate (PubChem CID 123136420) has the molecular formula C21H36N2O8 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl cyclopropanecarboxylate.
| Compound Name | 2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 123136420 |
| Molecular Formula | C21H36N2O8 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl cyclopropanecarboxylate |
| SMILES | CO[C@@H](C(=O)N[C@@H](C)C(=O)NCCOC(=O)C1CC1)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C21H36N2O8/c1-12(18(27)22-10-11-31-20(29)13-6-7-13)23-19(28)17(30-5)16(26)15(25)14(24)8-9-21(2,3)4/h8-9,12-17,24-26H,6-7,10-11H2,1-5H3,(H,22,27)(H,23,28)/t12-,14+,15-,16+,17+/m0/s1 |
| InChIKey | RGSLBRBAPQSSEG-BMQFZULRSA-N |
| XLogP | -0.74 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|