C21H38N2O8 — CID 123809428
2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl butanoate (PubChem CID 123809428) has the molecular formula C21H38N2O8 and a molecular weight of 446.54 g/mol. Its IUPAC name is 2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl butanoate.
| Compound Name | 2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl butanoate |
|---|---|
| PubChem CID | 123809428 |
| Molecular Formula | C21H38N2O8 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | 2-[[(2S)-2-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]propanoyl]amino]ethyl butanoate |
| SMILES | CCCC(=O)OCCNC(=O)[C@H](C)NC(=O)[C@H](OC)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C |
| InChI | InChI=1S/C21H38N2O8/c1-7-8-15(25)31-12-11-22-19(28)13(2)23-20(29)18(30-6)17(27)16(26)14(24)9-10-21(3,4)5/h9-10,13-14,16-18,24,26-27H,7-8,11-12H2,1-6H3,(H,22,28)(H,23,29)/t13-,14+,16-,17+,18+/m0/s1 |
| InChIKey | JHUVHNNNFOMNOU-KVDVXYDOSA-N |
| XLogP | -0.35 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|