C25H42N2O9 — CID 10164686
cyclohexyl [7-oxo-6-[[(E)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-2-yl] carbonate (PubChem CID 10164686) has the molecular formula C25H42N2O9 and a molecular weight of 514.62 g/mol. Its IUPAC name is cyclohexyl [7-oxo-6-[[(E)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-2-yl] carbonate.
| Compound Name | cyclohexyl [7-oxo-6-[[(E)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-2-yl] carbonate |
|---|---|
| PubChem CID | 10164686 |
| Molecular Formula | C25H42N2O9 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.29 |
| IUPAC Name | cyclohexyl [7-oxo-6-[[(E)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-2-yl] carbonate |
| SMILES | COC(C(=O)NC1CCCC(OC(=O)OC2CCCCC2)NC1=O)C(O)C(O)C(O)/C=C/C(C)(C)C |
| InChI | InChI=1S/C25H42N2O9/c1-25(2,3)14-13-17(28)19(29)20(30)21(34-4)23(32)26-16-11-8-12-18(27-22(16)31)36-24(33)35-15-9-6-5-7-10-15/h13-21,28-30H,5-12H2,1-4H3,(H,26,32)(H,27,31)/b14-13+ |
| InChIKey | JFAITINDVWTKGU-BUHFOSPRSA-N |
| XLogP | 1.28 |
| TPSA | 163.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|