C24H40N2O10 — CID 90761403
2,2-dimethylpropyl [(3R,6S)-7-oxo-6-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-9-oxonon-6-enoyl]amino]azepan-3-yl] carbonate (PubChem CID 90761403) has the molecular formula C24H40N2O10 and a molecular weight of 516.59 g/mol. Its IUPAC name is 2,2-dimethylpropyl [(3R,6S)-7-oxo-6-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-9-oxonon-6-enoyl]amino]azepan-3-yl] carbonate.
| Compound Name | 2,2-dimethylpropyl [(3R,6S)-7-oxo-6-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-9-oxonon-6-enoyl]amino]azepan-3-yl] carbonate |
|---|---|
| PubChem CID | 90761403 |
| Molecular Formula | C24H40N2O10 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2,2-dimethylpropyl [(3R,6S)-7-oxo-6-[[(2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethyl-9-oxonon-6-enoyl]amino]azepan-3-yl] carbonate |
| SMILES | CO[C@@H](C(=O)N[C@H]1CC[C@@H](OC(=O)OCC(C)(C)C)CNC1=O)[C@H](O)[C@@H](O)[C@H](O)C=CC(C)(C)C=O |
| InChI | InChI=1S/C24H40N2O10/c1-23(2,3)13-35-22(33)36-14-7-8-15(20(31)25-11-14)26-21(32)19(34-6)18(30)17(29)16(28)9-10-24(4,5)12-27/h9-10,12,14-19,28-30H,7-8,11,13H2,1-6H3,(H,25,31)(H,26,32)/t14-,15+,16-,17+,18-,19-/m1/s1 |
| InChIKey | KOTVMRYBLPMRJL-JWXAEQQXSA-N |
| XLogP | -0.17 |
| TPSA | 180.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|