C27H38N2O8 — CID 152760965
[(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 3-phenylprop-2-enoate (PubChem CID 152760965) has the molecular formula C27H38N2O8 and a molecular weight of 518.61 g/mol. Its IUPAC name is [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 3-phenylprop-2-enoate.
| Compound Name | [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 152760965 |
| Molecular Formula | C27H38N2O8 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [(3R,6S)-7-oxo-6-[[(E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8,8-dimethylnon-6-enoyl]amino]azepan-3-yl] 3-phenylprop-2-enoate |
| SMILES | CO[C@@H](C(=O)N[C@H]1CC[C@@H](OC(=O)C=Cc2ccccc2)CNC1=O)[C@H](O)[C@@H](O)[C@H](O)/C=C/C(C)(C)C |
| InChI | InChI=1S/C27H38N2O8/c1-27(2,3)15-14-20(30)22(32)23(33)24(36-4)26(35)29-19-12-11-18(16-28-25(19)34)37-21(31)13-10-17-8-6-5-7-9-17/h5-10,13-15,18-20,22-24,30,32-33H,11-12,16H2,1-4H3,(H,28,34)(H,29,35)/b13-10?,15-14+/t18-,19+,20-,22+,23-,24-/m1/s1 |
| InChIKey | DUVKBHALABIKCC-ORJUEBQDSA-N |
| XLogP | 0.71 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|