About 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran
1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran (PubChem CID 123727482) has the molecular formula C13H17FO
and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran.
Molecular Properties
| Compound Name | 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran |
| PubChem CID | 123727482 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran |
| SMILES | CCC1(C)OC(C)(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C13H17FO/c1-5-13(4)10-7-6-9(14)8-11(10)12(2,3)15-13/h6-8H,5H2,1-4H3 |
| InChIKey | OKYYWRGYPHCEHT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran?
The IUPAC name of 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran (CID 123727482) is 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran.
What is the SMILES notation for 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran?
The canonical SMILES for 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran is CCC1(C)OC(C)(C)c2cc(F)ccc21.
What is the InChIKey of 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran?
The InChIKey is OKYYWRGYPHCEHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17FO/c1-5-13(4)10-7-6-9(14)8-11(10)12(2,3)15-13/h6-8H,5H2,1-4H3.
What are the key properties of 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran?
1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran has a molecular weight of 208.28 g/mol, XLogP of 3.72, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran is sourced from PubChem (CID 123727482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).