C13H17FO — CID 123727482
1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran (PubChem CID 123727482) has the molecular formula C13H17FO and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran.
| Compound Name | 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran |
|---|---|
| PubChem CID | 123727482 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-ethyl-5-fluoro-1,3,3-trimethyl-2-benzofuran |
| SMILES | CCC1(C)OC(C)(C)c2cc(F)ccc21 |
| InChI | InChI=1S/C13H17FO/c1-5-13(4)10-7-6-9(14)8-11(10)12(2,3)15-13/h6-8H,5H2,1-4H3 |
| InChIKey | OKYYWRGYPHCEHT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |