C19H22N4O3 — CID 123728949
1-[6-[4-(morpholin-3-ylmethoxy)phenoxy]-3-pyridinyl]propane-1,3-diimine (PubChem CID 123728949) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 1-[6-[4-(morpholin-3-ylmethoxy)phenoxy]-3-pyridinyl]propane-1,3-diimine.
| Compound Name | 1-[6-[4-(morpholin-3-ylmethoxy)phenoxy]-3-pyridinyl]propane-1,3-diimine |
|---|---|
| PubChem CID | 123728949 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 1-[6-[4-(morpholin-3-ylmethoxy)phenoxy]-3-pyridinyl]propane-1,3-diimine |
| SMILES | [H]/N=C/C/C(=N\[H])c1ccc(Oc2ccc(OCC3COCCN3)cc2)nc1 |
| InChI | InChI=1S/C19H22N4O3/c20-8-7-18(21)14-1-6-19(23-11-14)26-17-4-2-16(3-5-17)25-13-15-12-24-10-9-22-15/h1-6,8,11,15,20-22H,7,9-10,12-13H2/b20-8+,21-18+ |
| InChIKey | NIQREJUBYILECI-JYSLFSDYSA-N |
| XLogP | 2.65 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|