About 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene
5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene (PubChem CID 123733561) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene.
Molecular Properties
| Compound Name | 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene |
| PubChem CID | 123733561 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene |
| SMILES | CC(C)C1C=CC=CC(C)C1C |
| InChI | InChI=1S/C12H20/c1-9(2)12-8-6-5-7-10(3)11(12)4/h5-12H,1-4H3 |
| InChIKey | MEDAVJKVVGRHLS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene?
The IUPAC name of 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene (CID 123733561) is 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene.
What is the SMILES notation for 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene?
The canonical SMILES for 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene is CC(C)C1C=CC=CC(C)C1C.
What is the InChIKey of 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene?
The InChIKey is MEDAVJKVVGRHLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-9(2)12-8-6-5-7-10(3)11(12)4/h5-12H,1-4H3.
What are the key properties of 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene?
5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene has a molecular weight of 164.29 g/mol, XLogP of 3.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-7-propan-2-ylcyclohepta-1,3-diene is sourced from PubChem (CID 123733561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).