C14H18OS — CID 123734693
2-(6-methyl-2,3,4,5-tetrahydrothiopyran-1-yl)-1-phenylethanone (PubChem CID 123734693) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is 2-(6-methyl-2,3,4,5-tetrahydrothiopyran-1-yl)-1-phenylethanone.
| Compound Name | 2-(6-methyl-2,3,4,5-tetrahydrothiopyran-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 123734693 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 2-(6-methyl-2,3,4,5-tetrahydrothiopyran-1-yl)-1-phenylethanone |
| SMILES | CC1=S(CC(=O)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C14H18OS/c1-12-7-5-6-10-16(12)11-14(15)13-8-3-2-4-9-13/h2-4,8-9H,5-7,10-11H2,1H3 |
| InChIKey | WOQFPXJXWFUJSF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|