C18H20O4S — CID 123735400
1-prop-2-enoxy-4-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)sulfonylbenzene (PubChem CID 123735400) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is 1-prop-2-enoxy-4-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)sulfonylbenzene.
| Compound Name | 1-prop-2-enoxy-4-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)sulfonylbenzene |
|---|---|
| PubChem CID | 123735400 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 1-prop-2-enoxy-4-(4-prop-2-enoxycyclohexa-2,4-dien-1-yl)sulfonylbenzene |
| SMILES | C=CCOC1=CCC(S(=O)(=O)c2ccc(OCC=C)cc2)C=C1 |
| InChI | InChI=1S/C18H20O4S/c1-3-13-21-15-5-9-17(10-6-15)23(19,20)18-11-7-16(8-12-18)22-14-4-2/h3-11,18H,1-2,12-14H2 |
| InChIKey | VMUMOWHYTMMDSB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|