C15H20N2O4S — CID 90122451
2-amino-N-cyclopropylsulfonyl-3-(4-prop-2-enoxyphenyl)propanamide (PubChem CID 90122451) has the molecular formula C15H20N2O4S and a molecular weight of 324.40 g/mol. Its IUPAC name is 2-amino-N-cyclopropylsulfonyl-3-(4-prop-2-enoxyphenyl)propanamide.
| Compound Name | 2-amino-N-cyclopropylsulfonyl-3-(4-prop-2-enoxyphenyl)propanamide |
|---|---|
| PubChem CID | 90122451 |
| Molecular Formula | C15H20N2O4S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 2-amino-N-cyclopropylsulfonyl-3-(4-prop-2-enoxyphenyl)propanamide |
| SMILES | C=CCOc1ccc(CC(N)C(=O)NS(=O)(=O)C2CC2)cc1 |
| InChI | InChI=1S/C15H20N2O4S/c1-2-9-21-12-5-3-11(4-6-12)10-14(16)15(18)17-22(19,20)13-7-8-13/h2-6,13-14H,1,7-10,16H2,(H,17,18) |
| InChIKey | KKFZAMSWCRCDRR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|