C17H23N — CID 123735693
N-benzyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine (PubChem CID 123735693) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is N-benzyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine.
| Compound Name | N-benzyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 123735693 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | N-benzyl-1,2,3,4,4a,5,6,7-octahydronaphthalen-1-amine |
| SMILES | C1=C2C(CCC1)CCCC2NCc1ccccc1 |
| InChI | InChI=1S/C17H23N/c1-2-7-14(8-3-1)13-18-17-12-6-10-15-9-4-5-11-16(15)17/h1-3,7-8,11,15,17-18H,4-6,9-10,12-13H2 |
| InChIKey | YWWJVMCNTHUDLJ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|