C20H22BN3O2 — CID 123739071
1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]triazole (PubChem CID 123739071) has the molecular formula C20H22BN3O2 and a molecular weight of 347.23 g/mol. Its IUPAC name is 1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]triazole.
| Compound Name | 1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]triazole |
|---|---|
| PubChem CID | 123739071 |
| Molecular Formula | C20H22BN3O2 |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | 1-[4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]phenyl]triazole |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(-n4ccnn4)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H22BN3O2/c1-19(2)20(3,4)26-21(25-19)17-9-5-15(6-10-17)16-7-11-18(12-8-16)24-14-13-22-23-24/h5-14H,1-4H3 |
| InChIKey | YCTFIQCMFXGXRD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|