C13H23N3 — CID 123742591
1-[1-(2,3-dihydropyridin-2-yl)-2-methylpropyl]piperazine (PubChem CID 123742591) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 1-[1-(2,3-dihydropyridin-2-yl)-2-methylpropyl]piperazine.
| Compound Name | 1-[1-(2,3-dihydropyridin-2-yl)-2-methylpropyl]piperazine |
|---|---|
| PubChem CID | 123742591 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 1-[1-(2,3-dihydropyridin-2-yl)-2-methylpropyl]piperazine |
| SMILES | CC(C)C(C1CC=CC=N1)N1CCNCC1 |
| InChI | InChI=1S/C13H23N3/c1-11(2)13(12-5-3-4-6-15-12)16-9-7-14-8-10-16/h3-4,6,11-14H,5,7-10H2,1-2H3 |
| InChIKey | OSWLBVQSFFVYQB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |