C9H12N2 — CID 123742620
1-methyl-4-penta-1,3-dien-3-ylpyrazole (PubChem CID 123742620) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-methyl-4-penta-1,3-dien-3-ylpyrazole.
| Compound Name | 1-methyl-4-penta-1,3-dien-3-ylpyrazole |
|---|---|
| PubChem CID | 123742620 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-methyl-4-penta-1,3-dien-3-ylpyrazole |
| SMILES | C=CC(=CC)c1cnn(C)c1 |
| InChI | InChI=1S/C9H12N2/c1-4-8(5-2)9-6-10-11(3)7-9/h4-7H,1H2,2-3H3 |
| InChIKey | HYFCPYYDDQRPFY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|