About hexan-2-yl methanimidate
hexan-2-yl methanimidate (PubChem CID 123742650) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is hexan-2-yl methanimidate.
Molecular Properties
| Compound Name | hexan-2-yl methanimidate |
| PubChem CID | 123742650 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | hexan-2-yl methanimidate |
| SMILES | [H]/N=C/OC(C)CCCC |
| InChI | InChI=1S/C7H15NO/c1-3-4-5-7(2)9-6-8/h6-8H,3-5H2,1-2H3/b8-6+ |
| InChIKey | XIIYBUQJIUSPPR-SOFGYWHQSA-N |
| XLogP | 2.19 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze hexan-2-yl methanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-yl methanimidate?
The IUPAC name of hexan-2-yl methanimidate (CID 123742650) is hexan-2-yl methanimidate.
What is the SMILES notation for hexan-2-yl methanimidate?
The canonical SMILES for hexan-2-yl methanimidate is [H]/N=C/OC(C)CCCC.
What is the InChIKey of hexan-2-yl methanimidate?
The InChIKey is XIIYBUQJIUSPPR-SOFGYWHQSA-N. The full InChI is InChI=1S/C7H15NO/c1-3-4-5-7(2)9-6-8/h6-8H,3-5H2,1-2H3/b8-6+.
What are the key properties of hexan-2-yl methanimidate?
hexan-2-yl methanimidate has a molecular weight of 129.20 g/mol, XLogP of 2.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-yl methanimidate is sourced from PubChem (CID 123742650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).