C22H25FNO4+ — CID 123743109
1-(2-fluorophenyl)-3-(4-methoxyspiro[7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-6,1'-aziridin-1-ium]-5-yl)propan-2-ol (PubChem CID 123743109) has the molecular formula C22H25FNO4+ and a molecular weight of 386.44 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3-(4-methoxyspiro[7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-6,1'-aziridin-1-ium]-5-yl)propan-2-ol.
| Compound Name | 1-(2-fluorophenyl)-3-(4-methoxyspiro[7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-6,1'-aziridin-1-ium]-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 123743109 |
| Molecular Formula | C22H25FNO4+ |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-(2-fluorophenyl)-3-(4-methoxyspiro[7,8-dihydro-5H-[1,3]dioxolo[4,5-g]isoquinolin-6-ium-6,1'-aziridin-1-ium]-5-yl)propan-2-ol |
| SMILES | COc1c2c(cc3c1C(CC(O)Cc1ccccc1F)[N+]1(CC3)CC1)OCO2 |
| InChI | InChI=1S/C22H25FNO4/c1-26-22-20-15(11-19-21(22)28-13-27-19)6-7-24(8-9-24)18(20)12-16(25)10-14-4-2-3-5-17(14)23/h2-5,11,16,18,25H,6-10,12-13H2,1H3/q+1 |
| InChIKey | HSFZDSLPPGDMLY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|