C19H23N — CID 123745720
1,1-dimethyl-2-penta-1,3-dienyl-4,5,8,9-tetrahydrobenzo[e]indole (PubChem CID 123745720) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is 1,1-dimethyl-2-penta-1,3-dienyl-4,5,8,9-tetrahydrobenzo[e]indole.
| Compound Name | 1,1-dimethyl-2-penta-1,3-dienyl-4,5,8,9-tetrahydrobenzo[e]indole |
|---|---|
| PubChem CID | 123745720 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 1,1-dimethyl-2-penta-1,3-dienyl-4,5,8,9-tetrahydrobenzo[e]indole |
| SMILES | CC=CC=CC1=NC2=C(C3=C(C=CCC3)CC2)C1(C)C |
| InChI | InChI=1S/C19H23N/c1-4-5-6-11-17-19(2,3)18-15-10-8-7-9-14(15)12-13-16(18)20-17/h4-7,9,11H,8,10,12-13H2,1-3H3 |
| InChIKey | SLWCLHUCEDOQJT-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|