C15H20IrN- — CID 58983120
iridium;2,2,5,5-tetramethyl-6-phenyl-3,4-dihydropyridine (PubChem CID 58983120) has the molecular formula C15H20IrN- and a molecular weight of 406.55 g/mol. Its IUPAC name is iridium;2,2,5,5-tetramethyl-6-phenyl-3,4-dihydropyridine.
| Compound Name | iridium;2,2,5,5-tetramethyl-6-phenyl-3,4-dihydropyridine |
|---|---|
| PubChem CID | 58983120 |
| Molecular Formula | C15H20IrN- |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | iridium;2,2,5,5-tetramethyl-6-phenyl-3,4-dihydropyridine |
| SMILES | CC1(C)CCC(C)(C)C(c2[c-]cccc2)=N1.[Ir] |
| InChI | InChI=1S/C15H20N.Ir/c1-14(2)10-11-15(3,4)16-13(14)12-8-6-5-7-9-12;/h5-8H,10-11H2,1-4H3;/q-1; |
| InChIKey | BPKCYOLFYTZRCP-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|