C17H22IrN- — CID 58982954
5,5-dimethyl-6-(5,6,7,8-tetrahydro-2H-naphthalen-2-id-1-yl)-3,4-dihydro-2H-pyridine;iridium (PubChem CID 58982954) has the molecular formula C17H22IrN- and a molecular weight of 432.59 g/mol. Its IUPAC name is 5,5-dimethyl-6-(5,6,7,8-tetrahydro-2H-naphthalen-2-id-1-yl)-3,4-dihydro-2H-pyridine;iridium.
| Compound Name | 5,5-dimethyl-6-(5,6,7,8-tetrahydro-2H-naphthalen-2-id-1-yl)-3,4-dihydro-2H-pyridine;iridium |
|---|---|
| PubChem CID | 58982954 |
| Molecular Formula | C17H22IrN- |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 5,5-dimethyl-6-(5,6,7,8-tetrahydro-2H-naphthalen-2-id-1-yl)-3,4-dihydro-2H-pyridine;iridium |
| SMILES | CC1(C)CCCN=C1c1[c-]ccc2c1CCCC2.[Ir] |
| InChI | InChI=1S/C17H22N.Ir/c1-17(2)11-6-12-18-16(17)15-10-5-8-13-7-3-4-9-14(13)15;/h5,8H,3-4,6-7,9,11-12H2,1-2H3;/q-1; |
| InChIKey | LKOMVZXICQXKIG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|