C19H32O3S2 — CID 123754930
3-(13-propylsulfanyltrideca-5,8,11-trienylsulfinyl)propanoic acid (PubChem CID 123754930) has the molecular formula C19H32O3S2 and a molecular weight of 372.60 g/mol. Its IUPAC name is 3-(13-propylsulfanyltrideca-5,8,11-trienylsulfinyl)propanoic acid.
| Compound Name | 3-(13-propylsulfanyltrideca-5,8,11-trienylsulfinyl)propanoic acid |
|---|---|
| PubChem CID | 123754930 |
| Molecular Formula | C19H32O3S2 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 3-(13-propylsulfanyltrideca-5,8,11-trienylsulfinyl)propanoic acid |
| SMILES | CCCSCC=CCC=CCC=CCCCCS(=O)CCC(=O)O |
| InChI | InChI=1S/C19H32O3S2/c1-2-15-23-16-12-10-8-6-4-3-5-7-9-11-13-17-24(22)18-14-19(20)21/h4-7,10,12H,2-3,8-9,11,13-18H2,1H3,(H,20,21) |
| InChIKey | YNJZSDIVCPAICX-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|