C28H43NO2 — CID 123754952
2,7,9,11,23-pentamethyl-4-oxa-9-azapentacyclo[12.11.0.05,10.015,24.018,23]pentacosa-1,18-dien-20-one (PubChem CID 123754952) has the molecular formula C28H43NO2 and a molecular weight of 425.66 g/mol. Its IUPAC name is 2,7,9,11,23-pentamethyl-4-oxa-9-azapentacyclo[12.11.0.05,10.015,24.018,23]pentacosa-1,18-dien-20-one.
| Compound Name | 2,7,9,11,23-pentamethyl-4-oxa-9-azapentacyclo[12.11.0.05,10.015,24.018,23]pentacosa-1,18-dien-20-one |
|---|---|
| PubChem CID | 123754952 |
| Molecular Formula | C28H43NO2 |
| Molecular Weight | 425.66 g/mol |
| Exact Mass | 425.33 |
| IUPAC Name | 2,7,9,11,23-pentamethyl-4-oxa-9-azapentacyclo[12.11.0.05,10.015,24.018,23]pentacosa-1,18-dien-20-one |
| SMILES | CC1=C2CC3C(CCC4=CC(=O)CCC43C)C2CCC(C)C2C(CC(C)CN2C)OC1 |
| InChI | InChI=1S/C28H43NO2/c1-17-12-26-27(29(5)15-17)18(2)6-8-22-23-9-7-20-13-21(30)10-11-28(20,4)25(23)14-24(22)19(3)16-31-26/h13,17-18,22-23,25-27H,6-12,14-16H2,1-5H3 |
| InChIKey | GGGFOUVOEUJMDI-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|