About 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide
2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide (PubChem CID 123755220) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide |
| PubChem CID | 123755220 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide |
| SMILES | [H]/N=C(\C#N)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C10H11N3O2/c1-14-9-3-6(8(13)5-11)7(12)4-10(9)15-2/h3-4,13H,12H2,1-2H3/b13-8+ |
| InChIKey | OMILWRBWFWHXEO-MDWZMJQESA-N |
| XLogP | 1.18 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide?
The IUPAC name of 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide (CID 123755220) is 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide.
What is the SMILES notation for 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide?
The canonical SMILES for 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide is [H]/N=C(\C#N)c1cc(OC)c(OC)cc1N.
What is the InChIKey of 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide?
The InChIKey is OMILWRBWFWHXEO-MDWZMJQESA-N. The full InChI is InChI=1S/C10H11N3O2/c1-14-9-3-6(8(13)5-11)7(12)4-10(9)15-2/h3-4,13H,12H2,1-2H3/b13-8+.
What are the key properties of 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide?
2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide has a molecular weight of 205.22 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide is sourced from PubChem (CID 123755220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).