C10H11N3O2 — CID 123755220
2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide (PubChem CID 123755220) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide.
| Compound Name | 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide |
|---|---|
| PubChem CID | 123755220 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzenecarboximidoyl cyanide |
| SMILES | [H]/N=C(\C#N)c1cc(OC)c(OC)cc1N |
| InChI | InChI=1S/C10H11N3O2/c1-14-9-3-6(8(13)5-11)7(12)4-10(9)15-2/h3-4,13H,12H2,1-2H3/b13-8+ |
| InChIKey | OMILWRBWFWHXEO-MDWZMJQESA-N |
| XLogP | 1.18 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|