C10H13N5O — CID 123763796
1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine (PubChem CID 123763796) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 123763796 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-phenylmethoxy-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NCN(OCc2ccccc2)C(N)=N1 |
| InChI | InChI=1S/C10H13N5O/c11-9-13-7-15(10(12)14-9)16-6-8-4-2-1-3-5-8/h1-5H,6-7H2,(H4,11,12,13,14) |
| InChIKey | SAXNBYSJEHNWIY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |