C17H36 — CID 123763996
3,6,6-triethyl-3,4,4-trimethyloctane (PubChem CID 123763996) has the molecular formula C17H36 and a molecular weight of 240.47 g/mol. Its IUPAC name is 3,6,6-triethyl-3,4,4-trimethyloctane.
| Compound Name | 3,6,6-triethyl-3,4,4-trimethyloctane |
|---|---|
| PubChem CID | 123763996 |
| Molecular Formula | C17H36 |
| Molecular Weight | 240.47 g/mol |
| Exact Mass | 240.28 |
| IUPAC Name | 3,6,6-triethyl-3,4,4-trimethyloctane |
| SMILES | CCC(CC)(CC)CC(C)(C)C(C)(CC)CC |
| InChI | InChI=1S/C17H36/c1-9-16(8,10-2)15(6,7)14-17(11-3,12-4)13-5/h9-14H2,1-8H3 |
| InChIKey | GTOGOBOIJVPXGL-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.47 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |