C9H12OS — CID 123766485
3-(6-sulfanylcyclohexa-1,3-dien-1-yl)prop-2-en-1-ol (PubChem CID 123766485) has the molecular formula C9H12OS and a molecular weight of 168.26 g/mol. Its IUPAC name is 3-(6-sulfanylcyclohexa-1,3-dien-1-yl)prop-2-en-1-ol.
| Compound Name | 3-(6-sulfanylcyclohexa-1,3-dien-1-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 123766485 |
| Molecular Formula | C9H12OS |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 3-(6-sulfanylcyclohexa-1,3-dien-1-yl)prop-2-en-1-ol |
| SMILES | OCC=CC1=CC=CCC1S |
| InChI | InChI=1S/C9H12OS/c10-7-3-5-8-4-1-2-6-9(8)11/h1-5,9-11H,6-7H2 |
| InChIKey | DENNGVFGSKUNNR-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|