C7H8OS — CID 163804141
cyclohexa-1,2,4-trien-1-yl(sulfanyl)methanol (PubChem CID 163804141) has the molecular formula C7H8OS and a molecular weight of 140.21 g/mol. Its IUPAC name is cyclohexa-1,2,4-trien-1-yl(sulfanyl)methanol.
| Compound Name | cyclohexa-1,2,4-trien-1-yl(sulfanyl)methanol |
|---|---|
| PubChem CID | 163804141 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | cyclohexa-1,2,4-trien-1-yl(sulfanyl)methanol |
| SMILES | OC(S)C1=C=CC=CC1 |
| InChI | InChI=1S/C7H8OS/c8-7(9)6-4-2-1-3-5-6/h1-3,7-9H,4H2 |
| InChIKey | NHNRAXDTPFNXBL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|