C29H36N2 — CID 123766942
8-butan-2-yl-5-tert-butyl-8-methyl-2,3-diphenyl-5,8a-dihydro-4aH-quinoxaline (PubChem CID 123766942) has the molecular formula C29H36N2 and a molecular weight of 412.62 g/mol. Its IUPAC name is 8-butan-2-yl-5-tert-butyl-8-methyl-2,3-diphenyl-5,8a-dihydro-4aH-quinoxaline.
| Compound Name | 8-butan-2-yl-5-tert-butyl-8-methyl-2,3-diphenyl-5,8a-dihydro-4aH-quinoxaline |
|---|---|
| PubChem CID | 123766942 |
| Molecular Formula | C29H36N2 |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.29 |
| IUPAC Name | 8-butan-2-yl-5-tert-butyl-8-methyl-2,3-diphenyl-5,8a-dihydro-4aH-quinoxaline |
| SMILES | CCC(C)C1(C)C=CC(C(C)(C)C)C2N=C(c3ccccc3)C(c3ccccc3)=NC21 |
| InChI | InChI=1S/C29H36N2/c1-7-20(2)29(6)19-18-23(28(3,4)5)26-27(29)31-25(22-16-12-9-13-17-22)24(30-26)21-14-10-8-11-15-21/h8-20,23,26-27H,7H2,1-6H3 |
| InChIKey | VGHVFWUDJYZQBB-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|