C21H25IN2 — CID 13117565
1,2,2-triethyl-4,5-diphenylimidazol-1-ium iodide (PubChem CID 13117565) has the molecular formula C21H25IN2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1,2,2-triethyl-4,5-diphenylimidazol-1-ium iodide.
| Compound Name | 1,2,2-triethyl-4,5-diphenylimidazol-1-ium iodide |
|---|---|
| PubChem CID | 13117565 |
| Molecular Formula | C21H25IN2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 1,2,2-triethyl-4,5-diphenylimidazol-1-ium iodide |
| SMILES | CC[N+]1=C(c2ccccc2)C(c2ccccc2)=NC1(CC)CC.[I-] |
| InChI | InChI=1S/C21H25N2.HI/c1-4-21(5-2)22-19(17-13-9-7-10-14-17)20(23(21)6-3)18-15-11-8-12-16-18;/h7-16H,4-6H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | OYLWCMICYYVWBF-UHFFFAOYSA-M |
| XLogP | 1.53 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|