C17H26 — CID 123767208
2,6,9-trimethyl-5-methylidene-4-prop-1-en-2-yldeca-1,3,9-triene (PubChem CID 123767208) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is 2,6,9-trimethyl-5-methylidene-4-prop-1-en-2-yldeca-1,3,9-triene.
| Compound Name | 2,6,9-trimethyl-5-methylidene-4-prop-1-en-2-yldeca-1,3,9-triene |
|---|---|
| PubChem CID | 123767208 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2,6,9-trimethyl-5-methylidene-4-prop-1-en-2-yldeca-1,3,9-triene |
| SMILES | C=C(C)C=C(C(=C)C)C(=C)C(C)CCC(=C)C |
| InChI | InChI=1S/C17H26/c1-12(2)9-10-15(7)16(8)17(14(5)6)11-13(3)4/h11,15H,1,3,5,8-10H2,2,4,6-7H3 |
| InChIKey | REZSKNSLMRCHFA-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|