C13H21FO — CID 163264610
(7E)-8-fluoro-3,9-dimethyl-6-methylidenedeca-7,9-dien-2-one;molecular hydrogen (PubChem CID 163264610) has the molecular formula C13H21FO and a molecular weight of 212.31 g/mol. Its IUPAC name is (7E)-8-fluoro-3,9-dimethyl-6-methylidenedeca-7,9-dien-2-one;molecular hydrogen.
| Compound Name | (7E)-8-fluoro-3,9-dimethyl-6-methylidenedeca-7,9-dien-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 163264610 |
| Molecular Formula | C13H21FO |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.16 |
| IUPAC Name | (7E)-8-fluoro-3,9-dimethyl-6-methylidenedeca-7,9-dien-2-one;molecular hydrogen |
| SMILES | C=C(/C=C(/F)C(=C)C)CCC(C)C(C)=O.[H][H] |
| InChI | InChI=1S/C13H19FO.H2/c1-9(2)13(14)8-10(3)6-7-11(4)12(5)15;/h8,11H,1,3,6-7H2,2,4-5H3;1H/b13-8+; |
| InChIKey | DBRMYFTUDMICEP-FNXZNAJJSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|