C26H20N2O4S — CID 1237674
5-(1,3-benzodioxol-5-ylmethylidene)-1-(2,4-dimethylphenyl)-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1237674) has the molecular formula C26H20N2O4S and a molecular weight of 456.52 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethylidene)-1-(2,4-dimethylphenyl)-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1-(2,4-dimethylphenyl)-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1237674 |
| Molecular Formula | C26H20N2O4S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethylidene)-1-(2,4-dimethylphenyl)-3-phenyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)C(=Cc3ccc4c(c3)OCO4)C(=O)N(c3ccccc3)C2=S)c(C)c1 |
| InChI | InChI=1S/C26H20N2O4S/c1-16-8-10-21(17(2)12-16)28-25(30)20(13-18-9-11-22-23(14-18)32-15-31-22)24(29)27(26(28)33)19-6-4-3-5-7-19/h3-14H,15H2,1-2H3 |
| InChIKey | HIMFAPZXOPAGKM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|