C13H18NO6+ — CID 123773903
2-[2-(5-oxo-3,4-dihydro-2H-pyrrol-4-ylium-1-yl)ethoxycarbonyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 123773903) has the molecular formula C13H18NO6+ and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[2-(5-oxo-3,4-dihydro-2H-pyrrol-4-ylium-1-yl)ethoxycarbonyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(5-oxo-3,4-dihydro-2H-pyrrol-4-ylium-1-yl)ethoxycarbonyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123773903 |
| Molecular Formula | C13H18NO6+ |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[2-(5-oxo-3,4-dihydro-2H-pyrrol-4-ylium-1-yl)ethoxycarbonyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)OCCN1CC[CH+]C1=O |
| InChI | InChI=1S/C13H18NO6/c1-10(2)12(16)18-8-9-20-13(17)19-7-6-14-5-3-4-11(14)15/h4H,1,3,5-9H2,2H3/q+1 |
| InChIKey | UPMISDCPRQBSQN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|