C29H35F2N5O4 — CID 123775854
11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(1-ethylazocan-4-yl)acetyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one (PubChem CID 123775854) has the molecular formula C29H35F2N5O4 and a molecular weight of 555.63 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(1-ethylazocan-4-yl)acetyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(1-ethylazocan-4-yl)acetyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
|---|---|
| PubChem CID | 123775854 |
| Molecular Formula | C29H35F2N5O4 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-4-[2-(1-ethylazocan-4-yl)acetyl]-13-methyl-5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,3,6,8-tetraen-12-one |
| SMILES | CCN1CCCCC(CC(=O)c2cc3c4c(cnc3[nH]2)CN(c2c(F)c(OC)cc(OC)c2F)C(=O)N4C)CC1 |
| InChI | InChI=1S/C29H35F2N5O4/c1-5-35-10-7-6-8-17(9-11-35)12-21(37)20-13-19-26-18(15-32-28(19)33-20)16-36(29(38)34(26)2)27-24(30)22(39-3)14-23(40-4)25(27)31/h13-15,17H,5-12,16H2,1-4H3,(H,32,33) |
| InChIKey | WHCQIMNMPGPJKX-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 91.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |