C30H46N2O8 — CID 123775990
(2,5-dihydroxypyrrol-1-yl) 4-[2-[3-[3-(9-bicyclo[6.1.0]non-4-ynylmethoxy)-3-methylbutoxy]-3-methylbutoxy]ethylamino]-4-oxobutanoate (PubChem CID 123775990) has the molecular formula C30H46N2O8 and a molecular weight of 562.70 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[2-[3-[3-(9-bicyclo[6.1.0]non-4-ynylmethoxy)-3-methylbutoxy]-3-methylbutoxy]ethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-[3-[3-(9-bicyclo[6.1.0]non-4-ynylmethoxy)-3-methylbutoxy]-3-methylbutoxy]ethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123775990 |
| Molecular Formula | C30H46N2O8 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.33 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-[3-[3-(9-bicyclo[6.1.0]non-4-ynylmethoxy)-3-methylbutoxy]-3-methylbutoxy]ethylamino]-4-oxobutanoate |
| SMILES | CC(C)(CCOCCNC(=O)CCC(=O)On1c(O)ccc1O)OCCC(C)(C)OCC1C2CCC#CCCC21 |
| InChI | InChI=1S/C30H46N2O8/c1-29(2,38-19-16-30(3,4)39-21-24-22-9-7-5-6-8-10-23(22)24)15-18-37-20-17-31-25(33)11-14-28(36)40-32-26(34)12-13-27(32)35/h12-13,22-24,34-35H,7-11,14-21H2,1-4H3,(H,31,33) |
| InChIKey | HANZVPFUIRYRRA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|