C23H36N2O7 — CID 123268693
(2,5-dihydroxypyrrol-1-yl) 4-[2-[3-ethyl-1-(2-methylpent-4-yn-2-yloxy)pentan-3-yl]oxyethylamino]-4-oxobutanoate (PubChem CID 123268693) has the molecular formula C23H36N2O7 and a molecular weight of 452.55 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 4-[2-[3-ethyl-1-(2-methylpent-4-yn-2-yloxy)pentan-3-yl]oxyethylamino]-4-oxobutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-[3-ethyl-1-(2-methylpent-4-yn-2-yloxy)pentan-3-yl]oxyethylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 123268693 |
| Molecular Formula | C23H36N2O7 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 4-[2-[3-ethyl-1-(2-methylpent-4-yn-2-yloxy)pentan-3-yl]oxyethylamino]-4-oxobutanoate |
| SMILES | C#CCC(C)(C)OCCC(CC)(CC)OCCNC(=O)CCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C23H36N2O7/c1-6-13-22(4,5)30-16-14-23(7-2,8-3)31-17-15-24-18(26)9-12-21(29)32-25-19(27)10-11-20(25)28/h1,10-11,27-28H,7-9,12-17H2,2-5H3,(H,24,26) |
| InChIKey | XFPDLJJJIPAPKQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|