C18H21NO2 — CID 123779385
ethyl 2-(4-iminocyclohex-2-en-1-yl)-3-phenylcyclopropane-1-carboxylate (PubChem CID 123779385) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is ethyl 2-(4-iminocyclohex-2-en-1-yl)-3-phenylcyclopropane-1-carboxylate.
| Compound Name | ethyl 2-(4-iminocyclohex-2-en-1-yl)-3-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 123779385 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | ethyl 2-(4-iminocyclohex-2-en-1-yl)-3-phenylcyclopropane-1-carboxylate |
| SMILES | [H]/N=C1/C=CC(C2C(C(=O)OCC)C2c2ccccc2)CC1 |
| InChI | InChI=1S/C18H21NO2/c1-2-21-18(20)17-15(12-6-4-3-5-7-12)16(17)13-8-10-14(19)11-9-13/h3-8,10,13,15-17,19H,2,9,11H2,1H3/b19-14- |
| InChIKey | JMJPPZSTCUPYTQ-RGEXLXHISA-N |
| XLogP | 3.57 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|