C15H29BrO3 — CID 123783471
3-bromo-2-ethyl-9-pentyloxonane-5,6-diol (PubChem CID 123783471) has the molecular formula C15H29BrO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is 3-bromo-2-ethyl-9-pentyloxonane-5,6-diol.
| Compound Name | 3-bromo-2-ethyl-9-pentyloxonane-5,6-diol |
|---|---|
| PubChem CID | 123783471 |
| Molecular Formula | C15H29BrO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-bromo-2-ethyl-9-pentyloxonane-5,6-diol |
| SMILES | CCCCCC1CCC(O)C(O)CC(Br)C(CC)O1 |
| InChI | InChI=1S/C15H29BrO3/c1-3-5-6-7-11-8-9-13(17)14(18)10-12(16)15(4-2)19-11/h11-15,17-18H,3-10H2,1-2H3 |
| InChIKey | ZURZBBJGOPIYFV-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|