C9H16ClN3 — CID 123786733
3-(chloromethyl)-5-methyl-4-(2-methylbutyl)-1,2,4-triazole (PubChem CID 123786733) has the molecular formula C9H16ClN3 and a molecular weight of 201.70 g/mol. Its IUPAC name is 3-(chloromethyl)-5-methyl-4-(2-methylbutyl)-1,2,4-triazole.
| Compound Name | 3-(chloromethyl)-5-methyl-4-(2-methylbutyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 123786733 |
| Molecular Formula | C9H16ClN3 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 3-(chloromethyl)-5-methyl-4-(2-methylbutyl)-1,2,4-triazole |
| SMILES | CCC(C)Cn1c(C)nnc1CCl |
| InChI | InChI=1S/C9H16ClN3/c1-4-7(2)6-13-8(3)11-12-9(13)5-10/h7H,4-6H2,1-3H3 |
| InChIKey | LDTDIVQGUHCTLA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|