C15H20N2O — CID 123787092
benzyl 1-prop-1-en-2-ylpyrrolidine-2-carboximidate (PubChem CID 123787092) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is benzyl 1-prop-1-en-2-ylpyrrolidine-2-carboximidate.
| Compound Name | benzyl 1-prop-1-en-2-ylpyrrolidine-2-carboximidate |
|---|---|
| PubChem CID | 123787092 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | benzyl 1-prop-1-en-2-ylpyrrolidine-2-carboximidate |
| SMILES | [H]/N=C(\OCc1ccccc1)C1CCCN1C(=C)C |
| InChI | InChI=1S/C15H20N2O/c1-12(2)17-10-6-9-14(17)15(16)18-11-13-7-4-3-5-8-13/h3-5,7-8,14,16H,1,6,9-11H2,2H3/b16-15- |
| InChIKey | NUHIPZPVGHBJMA-NXVVXOECSA-N |
| XLogP | 3.18 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|