C13H15N3O — CID 59412335
benzyl (2S)-2-cyanopyrrolidine-1-carboximidate (PubChem CID 59412335) has the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. Its IUPAC name is benzyl (2S)-2-cyanopyrrolidine-1-carboximidate.
| Compound Name | benzyl (2S)-2-cyanopyrrolidine-1-carboximidate |
|---|---|
| PubChem CID | 59412335 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | benzyl (2S)-2-cyanopyrrolidine-1-carboximidate |
| SMILES | [H]/N=C(\OCc1ccccc1)N1CCC[C@H]1C#N |
| InChI | InChI=1S/C13H15N3O/c14-9-12-7-4-8-16(12)13(15)17-10-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-8,10H2/b15-13-/t12-/m0/s1 |
| InChIKey | JVXFDMLDGSEKGW-AHAXBBEGSA-N |
| XLogP | 2.13 |
| TPSA | 60.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|