C30H47NO — CID 123787243
1-cyclohex-3-en-1-yl-9-[3-(6-methylcycloocta-1,4,7-trien-1-yl)prop-2-enylamino]-5-propylnonan-1-one (PubChem CID 123787243) has the molecular formula C30H47NO and a molecular weight of 437.71 g/mol. Its IUPAC name is 1-cyclohex-3-en-1-yl-9-[3-(6-methylcycloocta-1,4,7-trien-1-yl)prop-2-enylamino]-5-propylnonan-1-one.
| Compound Name | 1-cyclohex-3-en-1-yl-9-[3-(6-methylcycloocta-1,4,7-trien-1-yl)prop-2-enylamino]-5-propylnonan-1-one |
|---|---|
| PubChem CID | 123787243 |
| Molecular Formula | C30H47NO |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 437.37 |
| IUPAC Name | 1-cyclohex-3-en-1-yl-9-[3-(6-methylcycloocta-1,4,7-trien-1-yl)prop-2-enylamino]-5-propylnonan-1-one |
| SMILES | CCCC(CCCCNCC=CC1=CCC=CC(C)C=C1)CCCC(=O)C1CC=CCC1 |
| InChI | InChI=1S/C30H47NO/c1-3-13-27(17-11-21-30(32)29-19-5-4-6-20-29)16-9-10-24-31-25-12-18-28-15-8-7-14-26(2)22-23-28/h4-5,7,12,14-15,18,22-23,26-27,29,31H,3,6,8-11,13,16-17,19-21,24-25H2,1-2H3 |
| InChIKey | JTZVYLNRQWHIEE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|