C17H17F6N2O+ — CID 123791080
4-methyl-6-[4-(trifluoromethoxy)hepta-2,4-dienyl]-3-(trifluoromethyl)imidazo[1,5-a]pyridin-4-ium (PubChem CID 123791080) has the molecular formula C17H17F6N2O+ and a molecular weight of 379.32 g/mol. Its IUPAC name is 4-methyl-6-[4-(trifluoromethoxy)hepta-2,4-dienyl]-3-(trifluoromethyl)imidazo[1,5-a]pyridin-4-ium.
| Compound Name | 4-methyl-6-[4-(trifluoromethoxy)hepta-2,4-dienyl]-3-(trifluoromethyl)imidazo[1,5-a]pyridin-4-ium |
|---|---|
| PubChem CID | 123791080 |
| Molecular Formula | C17H17F6N2O+ |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 4-methyl-6-[4-(trifluoromethoxy)hepta-2,4-dienyl]-3-(trifluoromethyl)imidazo[1,5-a]pyridin-4-ium |
| SMILES | CCC=C(C=CCC1=C[N+]2(C)C(=CN=C2C(F)(F)F)C=C1)OC(F)(F)F |
| InChI | InChI=1S/C17H17F6N2O/c1-3-5-14(26-17(21,22)23)7-4-6-12-8-9-13-10-24-15(16(18,19)20)25(13,2)11-12/h4-5,7-11H,3,6H2,1-2H3/q+1 |
| InChIKey | ACYZWFNSNPWYSC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|